C30H36F2N6O2 — CID 163810860
N-[6-amino-3-[(3,5-difluorophenyl)methyl]cyclohexa-2,4-diene-1-carboximidoyl]-2-(oxan-4-ylamino)-4-piperazin-1-ylbenzamide (PubChem CID 163810860) has the molecular formula C30H36F2N6O2 and a molecular weight of 550.65 g/mol. Its IUPAC name is N-[6-amino-3-[(3,5-difluorophenyl)methyl]cyclohexa-2,4-diene-1-carboximidoyl]-2-(oxan-4-ylamino)-4-piperazin-1-ylbenzamide.
| Compound Name | N-[6-amino-3-[(3,5-difluorophenyl)methyl]cyclohexa-2,4-diene-1-carboximidoyl]-2-(oxan-4-ylamino)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 163810860 |
| Molecular Formula | C30H36F2N6O2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | N-[6-amino-3-[(3,5-difluorophenyl)methyl]cyclohexa-2,4-diene-1-carboximidoyl]-2-(oxan-4-ylamino)-4-piperazin-1-ylbenzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(N2CCNCC2)cc1NC1CCOCC1)C1C=C(Cc2cc(F)cc(F)c2)C=CC1N |
| InChI | InChI=1S/C30H36F2N6O2/c31-21-14-20(15-22(32)17-21)13-19-1-4-27(33)26(16-19)29(34)37-30(39)25-3-2-24(38-9-7-35-8-10-38)18-28(25)36-23-5-11-40-12-6-23/h1-4,14-18,23,26-27,35-36H,5-13,33H2,(H2,34,37,39) |
| InChIKey | NNCMREVLNOYHDB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|