C24H24FN3O2S — CID 163810912
1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2-fluoroethyl)-5-methyl-7,8-dihydro-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 163810912) has the molecular formula C24H24FN3O2S and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2-fluoroethyl)-5-methyl-7,8-dihydro-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2-fluoroethyl)-5-methyl-7,8-dihydro-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 163810912 |
| Molecular Formula | C24H24FN3O2S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2-fluoroethyl)-5-methyl-7,8-dihydro-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC1=C2C(=O)N(CCF)CN(C3c4ccccc4CSc4ccccc43)N2CCC1=O |
| InChI | InChI=1S/C24H24FN3O2S/c1-16-20(29)10-12-27-22(16)24(30)26(13-11-25)15-28(27)23-18-7-3-2-6-17(18)14-31-21-9-5-4-8-19(21)23/h2-9,23H,10-15H2,1H3 |
| InChIKey | NNDSYHSBGRUSGC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |