C31H30N2O7S — CID 163811069
1-(3-methoxypropyl)-6-[2-oxo-2-[1-(2-oxochromen-6-yl)sulfonylpiperidin-3-yl]ethyl]benzo[cd]indol-2-one (PubChem CID 163811069) has the molecular formula C31H30N2O7S and a molecular weight of 574.66 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-6-[2-oxo-2-[1-(2-oxochromen-6-yl)sulfonylpiperidin-3-yl]ethyl]benzo[cd]indol-2-one.
| Compound Name | 1-(3-methoxypropyl)-6-[2-oxo-2-[1-(2-oxochromen-6-yl)sulfonylpiperidin-3-yl]ethyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 163811069 |
| Molecular Formula | C31H30N2O7S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 1-(3-methoxypropyl)-6-[2-oxo-2-[1-(2-oxochromen-6-yl)sulfonylpiperidin-3-yl]ethyl]benzo[cd]indol-2-one |
| SMILES | COCCCN1C(=O)c2cccc3c(CC(=O)C4CCCN(S(=O)(=O)c5ccc6oc(=O)ccc6c5)C4)ccc1c23 |
| InChI | InChI=1S/C31H30N2O7S/c1-39-16-4-15-33-26-11-8-20(24-6-2-7-25(30(24)26)31(33)36)18-27(34)22-5-3-14-32(19-22)41(37,38)23-10-12-28-21(17-23)9-13-29(35)40-28/h2,6-13,17,22H,3-5,14-16,18-19H2,1H3 |
| InChIKey | NNHHPELTQQLQTQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|