C26H26Br2N2O5S2 — CID 163500149
6-[2-[1-(4,5-dibromothiophen-2-yl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one (PubChem CID 163500149) has the molecular formula C26H26Br2N2O5S2 and a molecular weight of 670.45 g/mol. Its IUPAC name is 6-[2-[1-(4,5-dibromothiophen-2-yl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one.
| Compound Name | 6-[2-[1-(4,5-dibromothiophen-2-yl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 163500149 |
| Molecular Formula | C26H26Br2N2O5S2 |
| Molecular Weight | 670.45 g/mol |
| Exact Mass | 667.96 |
| IUPAC Name | 6-[2-[1-(4,5-dibromothiophen-2-yl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one |
| SMILES | COCCCN1C(=O)c2cccc3c(CC(=O)C4CCCCN4S(=O)(=O)c4cc(Br)c(Br)s4)ccc1c23 |
| InChI | InChI=1S/C26H26Br2N2O5S2/c1-35-13-5-11-29-21-10-9-16(17-6-4-7-18(24(17)21)26(29)32)14-22(31)20-8-2-3-12-30(20)37(33,34)23-15-19(27)25(28)36-23/h4,6-7,9-10,15,20H,2-3,5,8,11-14H2,1H3 |
| InChIKey | QTUCWCJTXIYCBH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|