C29H32N4O6S — CID 166751071
1-(4-acetamidophenyl)sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide (PubChem CID 166751071) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-(4-acetamidophenyl)sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide.
| Compound Name | 1-(4-acetamidophenyl)sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 166751071 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-(4-acetamidophenyl)sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide |
| SMILES | COCCCN1C(=O)c2cccc3c(NC(=O)C4CCCCN4S(=O)(=O)c4ccc(NC(C)=O)cc4)ccc1c23 |
| InChI | InChI=1S/C29H32N4O6S/c1-19(34)30-20-10-12-21(13-11-20)40(37,38)33-17-4-3-9-26(33)28(35)31-24-14-15-25-27-22(24)7-5-8-23(27)29(36)32(25)16-6-18-39-2/h5,7-8,10-15,26H,3-4,6,9,16-18H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | WVLCCWCBHCIWRC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|