C28H31N3O5S — CID 16863418
N-(1-butyl-2-oxobenzo[cd]indol-6-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16863418) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-(1-butyl-2-oxobenzo[cd]indol-6-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(1-butyl-2-oxobenzo[cd]indol-6-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863418 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | N-(1-butyl-2-oxobenzo[cd]indol-6-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)c2cccc3c(NC(=O)C4CCCN(S(=O)(=O)c5ccc(OC)cc5)C4)ccc1c23 |
| InChI | InChI=1S/C28H31N3O5S/c1-3-4-17-31-25-15-14-24(22-8-5-9-23(26(22)25)28(31)33)29-27(32)19-7-6-16-30(18-19)37(34,35)21-12-10-20(36-2)11-13-21/h5,8-15,19H,3-4,6-7,16-18H2,1-2H3,(H,29,32) |
| InChIKey | RVMIPWHVTKTQKG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |