C33H32FN3O5S — CID 166950164
1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide (PubChem CID 166950164) has the molecular formula C33H32FN3O5S and a molecular weight of 601.70 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide.
| Compound Name | 1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 166950164 |
| Molecular Formula | C33H32FN3O5S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-2-carboxamide |
| SMILES | COCCCN1C(=O)c2cccc3c(NC(=O)C4CCCCN4S(=O)(=O)c4ccc(-c5ccc(F)cc5)cc4)ccc1c23 |
| InChI | InChI=1S/C33H32FN3O5S/c1-42-21-5-19-36-29-18-17-28(26-6-4-7-27(31(26)29)33(36)39)35-32(38)30-8-2-3-20-37(30)43(40,41)25-15-11-23(12-16-25)22-9-13-24(34)14-10-22/h4,6-7,9-18,30H,2-3,5,8,19-21H2,1H3,(H,35,38) |
| InChIKey | CLBPUFPXHSUBGB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|