C29H29N3O5S2 — CID 166751261
1-(1-benzothiophen-3-ylsulfonyl)-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-4-carboxamide (PubChem CID 166751261) has the molecular formula C29H29N3O5S2 and a molecular weight of 563.70 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylsulfonyl)-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-4-carboxamide.
| Compound Name | 1-(1-benzothiophen-3-ylsulfonyl)-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166751261 |
| Molecular Formula | C29H29N3O5S2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 1-(1-benzothiophen-3-ylsulfonyl)-N-[1-(3-methoxypropyl)-2-oxobenzo[cd]indol-6-yl]piperidine-4-carboxamide |
| SMILES | COCCCN1C(=O)c2cccc3c(NC(=O)C4CCN(S(=O)(=O)c5csc6ccccc56)CC4)ccc1c23 |
| InChI | InChI=1S/C29H29N3O5S2/c1-37-17-5-14-32-24-11-10-23(20-7-4-8-22(27(20)24)29(32)34)30-28(33)19-12-15-31(16-13-19)39(35,36)26-18-38-25-9-3-2-6-21(25)26/h2-4,6-11,18-19H,5,12-17H2,1H3,(H,30,33) |
| InChIKey | IGNYQJFBPWCAAN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|