C30H34N2O7S — CID 163520255
6-[2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one (PubChem CID 163520255) has the molecular formula C30H34N2O7S and a molecular weight of 566.68 g/mol. Its IUPAC name is 6-[2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one.
| Compound Name | 6-[2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 163520255 |
| Molecular Formula | C30H34N2O7S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 6-[2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]-2-oxoethyl]-1-(3-methoxypropyl)benzo[cd]indol-2-one |
| SMILES | COCCCN1C(=O)c2cccc3c(CC(=O)C4CCCCN4S(=O)(=O)c4ccc(OC)c(OC)c4)ccc1c23 |
| InChI | InChI=1S/C30H34N2O7S/c1-37-17-7-15-31-25-13-11-20(22-8-6-9-23(29(22)25)30(31)34)18-26(33)24-10-4-5-16-32(24)40(35,36)21-12-14-27(38-2)28(19-21)39-3/h6,8-9,11-14,19,24H,4-5,7,10,15-18H2,1-3H3 |
| InChIKey | DKEXABAULMVRNF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|