C29H34N4O6S — CID 166751072
1-(4-acetamidophenyl)sulfonyl-N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]piperidine-2-carboxamide (PubChem CID 166751072) has the molecular formula C29H34N4O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is 1-(4-acetamidophenyl)sulfonyl-N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]piperidine-2-carboxamide.
| Compound Name | 1-(4-acetamidophenyl)sulfonyl-N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 166751072 |
| Molecular Formula | C29H34N4O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 1-(4-acetamidophenyl)sulfonyl-N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]piperidine-2-carboxamide |
| SMILES | COCCCNc1ccc(NC(=O)C2CCCCN2S(=O)(=O)c2ccc(NC(C)=O)cc2)c2cccc(C=O)c12 |
| InChI | InChI=1S/C29H34N4O6S/c1-20(35)31-22-10-12-23(13-11-22)40(37,38)33-17-4-3-9-27(33)29(36)32-25-14-15-26(30-16-6-18-39-2)28-21(19-34)7-5-8-24(25)28/h5,7-8,10-15,19,27,30H,3-4,6,9,16-18H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | KUYVYEGNOBEBQL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|