C30H31N3O5S — CID 166751161
N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]-1-(2-oxochromen-6-yl)sulfanylpiperidine-3-carboxamide (PubChem CID 166751161) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]-1-(2-oxochromen-6-yl)sulfanylpiperidine-3-carboxamide.
| Compound Name | N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]-1-(2-oxochromen-6-yl)sulfanylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166751161 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | N-[5-formyl-4-(3-methoxypropylamino)naphthalen-1-yl]-1-(2-oxochromen-6-yl)sulfanylpiperidine-3-carboxamide |
| SMILES | COCCCNc1ccc(NC(=O)C2CCCN(Sc3ccc4oc(=O)ccc4c3)C2)c2cccc(C=O)c12 |
| InChI | InChI=1S/C30H31N3O5S/c1-37-16-4-14-31-26-11-10-25(24-7-2-5-22(19-34)29(24)26)32-30(36)21-6-3-15-33(18-21)39-23-9-12-27-20(17-23)8-13-28(35)38-27/h2,5,7-13,17,19,21,31H,3-4,6,14-16,18H2,1H3,(H,32,36) |
| InChIKey | JBGXDQANNGSSCK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|