C26H32BrN3O5S2 — CID 166751340
1-[[(2R)-2-bromo-2,3-dihydrothiophen-5-yl]sulfonyl]-N-[5-formyl-4-[3-methoxypropyl(methyl)amino]naphthalen-1-yl]piperidine-4-carboxamide (PubChem CID 166751340) has the molecular formula C26H32BrN3O5S2 and a molecular weight of 610.60 g/mol. Its IUPAC name is 1-[[(2R)-2-bromo-2,3-dihydrothiophen-5-yl]sulfonyl]-N-[5-formyl-4-[3-methoxypropyl(methyl)amino]naphthalen-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-[[(2R)-2-bromo-2,3-dihydrothiophen-5-yl]sulfonyl]-N-[5-formyl-4-[3-methoxypropyl(methyl)amino]naphthalen-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166751340 |
| Molecular Formula | C26H32BrN3O5S2 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 1-[[(2R)-2-bromo-2,3-dihydrothiophen-5-yl]sulfonyl]-N-[5-formyl-4-[3-methoxypropyl(methyl)amino]naphthalen-1-yl]piperidine-4-carboxamide |
| SMILES | COCCCN(C)c1ccc(NC(=O)C2CCN(S(=O)(=O)C3=CC[C@@H](Br)S3)CC2)c2cccc(C=O)c12 |
| InChI | InChI=1S/C26H32BrN3O5S2/c1-29(13-4-16-35-2)22-8-7-21(20-6-3-5-19(17-31)25(20)22)28-26(32)18-11-14-30(15-12-18)37(33,34)24-10-9-23(27)36-24/h3,5-8,10,17-18,23H,4,9,11-16H2,1-2H3,(H,28,32)/t23-/m0/s1 |
| InChIKey | WTGOWTSFEQRQCJ-QHCPKHFHSA-N |
| XLogP | 4.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|