C20H31ClN4O4 — CID 87150500
tert-butyl 3-[[6-chloro-2-(3-methoxypropylamino)-3-pyridinyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 87150500) has the molecular formula C20H31ClN4O4 and a molecular weight of 426.95 g/mol. Its IUPAC name is tert-butyl 3-[[6-chloro-2-(3-methoxypropylamino)-3-pyridinyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-chloro-2-(3-methoxypropylamino)-3-pyridinyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87150500 |
| Molecular Formula | C20H31ClN4O4 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | tert-butyl 3-[[6-chloro-2-(3-methoxypropylamino)-3-pyridinyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COCCCNc1nc(Cl)ccc1NC(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H31ClN4O4/c1-20(2,3)29-19(27)25-11-5-7-14(13-25)18(26)23-15-8-9-16(21)24-17(15)22-10-6-12-28-4/h8-9,14H,5-7,10-13H2,1-4H3,(H,22,24)(H,23,26) |
| InChIKey | XSKVQTUPTODPJB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|