C10H17F — CID 163813389
4-cyclopropyl-1-(fluoromethyl)-2-methylcyclopentane (PubChem CID 163813389) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is 4-cyclopropyl-1-(fluoromethyl)-2-methylcyclopentane.
| Compound Name | 4-cyclopropyl-1-(fluoromethyl)-2-methylcyclopentane |
|---|---|
| PubChem CID | 163813389 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-cyclopropyl-1-(fluoromethyl)-2-methylcyclopentane |
| SMILES | CC1CC(C2CC2)CC1CF |
| InChI | InChI=1S/C10H17F/c1-7-4-9(8-2-3-8)5-10(7)6-11/h7-10H,2-6H2,1H3 |
| InChIKey | NPFVQYAYWPOERO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |