C21H24N4 — CID 163813806
(Z,2Z)-2-[amino(anilino)methylidene]-5-anilino-3,4-dimethylhex-3-enenitrile (PubChem CID 163813806) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is (Z,2Z)-2-[amino(anilino)methylidene]-5-anilino-3,4-dimethylhex-3-enenitrile.
| Compound Name | (Z,2Z)-2-[amino(anilino)methylidene]-5-anilino-3,4-dimethylhex-3-enenitrile |
|---|---|
| PubChem CID | 163813806 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (Z,2Z)-2-[amino(anilino)methylidene]-5-anilino-3,4-dimethylhex-3-enenitrile |
| SMILES | CC(/C(C#N)=C(\N)Nc1ccccc1)=C(\C)C(C)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4/c1-15(17(3)24-18-10-6-4-7-11-18)16(2)20(14-22)21(23)25-19-12-8-5-9-13-19/h4-13,17,24-25H,23H2,1-3H3/b16-15-,21-20+ |
| InChIKey | NPOMWJSDCGWFDR-SHRYNFLWSA-N |
| XLogP | 4.63 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|