C11H14N2O — CID 163815026
3-amino-6-propan-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 163815026) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-amino-6-propan-2-yl-2,3-dihydroisoindol-1-one.
| Compound Name | 3-amino-6-propan-2-yl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 163815026 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-amino-6-propan-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | CC(C)c1ccc2c(c1)C(=O)NC2N |
| InChI | InChI=1S/C11H14N2O/c1-6(2)7-3-4-8-9(5-7)11(14)13-10(8)12/h3-6,10H,12H2,1-2H3,(H,13,14) |
| InChIKey | NQOKHWTVEXZRLB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |