C18H22O2 — CID 170874182
2-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,3-dioxolane (PubChem CID 170874182) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,3-dioxolane.
| Compound Name | 2-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 170874182 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-1,3-dioxolane |
| SMILES | Cc1cc(C2OCCO2)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C18H22O2/c1-11(2)14-6-5-12(3)17-15(10-14)13(4)9-16(17)18-19-7-8-20-18/h5-6,9-11,18H,7-8H2,1-4H3 |
| InChIKey | ODOWZVOGIIQRLX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |