C34H37O2+ — CID 137316743
(2E)-2-(3,8-dimethyl-5-propan-2-ylazulen-8a-ylium-1-ylidene)-4-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-hydroxycyclobutan-1-one (PubChem CID 137316743) has the molecular formula C34H37O2+ and a molecular weight of 477.67 g/mol. Its IUPAC name is (2E)-2-(3,8-dimethyl-5-propan-2-ylazulen-8a-ylium-1-ylidene)-4-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-hydroxycyclobutan-1-one.
| Compound Name | (2E)-2-(3,8-dimethyl-5-propan-2-ylazulen-8a-ylium-1-ylidene)-4-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-hydroxycyclobutan-1-one |
|---|---|
| PubChem CID | 137316743 |
| Molecular Formula | C34H37O2+ |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | (2E)-2-(3,8-dimethyl-5-propan-2-ylazulen-8a-ylium-1-ylidene)-4-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-hydroxycyclobutan-1-one |
| SMILES | CC1=C/C(=C2/C(=O)C(c3cc(C)c4cc(C(C)C)ccc(C)c3-4)C2O)[c+]2c(C)ccc(C(C)C)cc21 |
| InChI | InChI=1S/C34H37O2/c1-17(2)23-11-9-19(5)29-25(15-23)21(7)13-27(29)31-33(35)32(34(31)36)28-14-22(8)26-16-24(18(3)4)12-10-20(6)30(26)28/h9-18,31,33,35H,1-8H3/q+1/b32-28- |
| InChIKey | PPGKCKJVDCIRBQ-BLCKFSMSSA-N |
| XLogP | 8.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|