C14H10FNO3 — CID 163819662
[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]methanediol (PubChem CID 163819662) has the molecular formula C14H10FNO3 and a molecular weight of 259.24 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]methanediol.
| Compound Name | [2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]methanediol |
|---|---|
| PubChem CID | 163819662 |
| Molecular Formula | C14H10FNO3 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]methanediol |
| SMILES | OC(O)c1cccc2oc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C14H10FNO3/c15-9-6-4-8(5-7-9)13-16-12-10(14(17)18)2-1-3-11(12)19-13/h1-7,14,17-18H |
| InChIKey | NUHNEQKJCJHFKQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|