C13H26N4O2 — CID 163819788
(2S)-2-[[dimethylamino(morpholin-4-yl)methylidene]amino]-N,3-dimethylbutanamide (PubChem CID 163819788) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is (2S)-2-[[dimethylamino(morpholin-4-yl)methylidene]amino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-[[dimethylamino(morpholin-4-yl)methylidene]amino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 163819788 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2S)-2-[[dimethylamino(morpholin-4-yl)methylidene]amino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](/N=C(\N(C)C)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C13H26N4O2/c1-10(2)11(12(18)14-3)15-13(16(4)5)17-6-8-19-9-7-17/h10-11H,6-9H2,1-5H3,(H,14,18)/b15-13+/t11-/m0/s1 |
| InChIKey | NUJUIKOQUZNPRL-VJSMGTLGSA-N |
| XLogP | 0.01 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|