C20H22N6O3 — CID 163821252
[[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]amino]-[5-(1H-pyrazol-4-yl)furan-2-yl]methanol (PubChem CID 163821252) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is [[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]amino]-[5-(1H-pyrazol-4-yl)furan-2-yl]methanol.
| Compound Name | [[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]amino]-[5-(1H-pyrazol-4-yl)furan-2-yl]methanol |
|---|---|
| PubChem CID | 163821252 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]amino]-[5-(1H-pyrazol-4-yl)furan-2-yl]methanol |
| SMILES | CCOCCn1cc(NC(O)c2ccc(-c3cn[nH]c3)o2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C20H22N6O3/c1-2-28-10-9-26-13-16(19(25-26)15-5-3-4-8-21-15)24-20(27)18-7-6-17(29-18)14-11-22-23-12-14/h3-8,11-13,20,24,27H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | NVOYJOWWCXOHES-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|