C23H26N6O5 — CID 122638653
5-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide;formic acid (PubChem CID 122638653) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide;formic acid.
| Compound Name | 5-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 122638653 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 5-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[1-(2-ethoxyethyl)-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide;formic acid |
| SMILES | CCOCCn1cc(NC(=O)c2ccc(-c3c(C)n[nH]c3C)o2)c(-c2ccccn2)n1.O=CO |
| InChI | InChI=1S/C22H24N6O3.CH2O2/c1-4-30-12-11-28-13-17(21(27-28)16-7-5-6-10-23-16)24-22(29)19-9-8-18(31-19)20-14(2)25-26-15(20)3;2-1-3/h5-10,13H,4,11-12H2,1-3H3,(H,24,29)(H,25,26);1H,(H,2,3) |
| InChIKey | OBDNEQOLXHJRTI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|