C27H34N6O8 — CID 175188659
formic acid;N-[1-[2-(2-methoxyethoxy)ethyl]-5-[1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-yl]-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide (PubChem CID 175188659) has the molecular formula C27H34N6O8 and a molecular weight of 570.60 g/mol. Its IUPAC name is formic acid;N-[1-[2-(2-methoxyethoxy)ethyl]-5-[1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-yl]-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide.
| Compound Name | formic acid;N-[1-[2-(2-methoxyethoxy)ethyl]-5-[1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-yl]-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 175188659 |
| Molecular Formula | C27H34N6O8 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | formic acid;N-[1-[2-(2-methoxyethoxy)ethyl]-5-[1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-yl]-3-pyridin-2-ylpyrazol-4-yl]furan-2-carboxamide |
| SMILES | COCCOCCn1cc(-c2c(NC(=O)c3ccco3)c(-c3ccccn3)nn2CCOCCOC)cn1.O=CO |
| InChI | InChI=1S/C26H32N6O6.CH2O2/c1-34-14-16-36-12-9-31-19-20(18-28-31)25-24(29-26(33)22-7-5-11-38-22)23(21-6-3-4-8-27-21)30-32(25)10-13-37-17-15-35-2;2-1-3/h3-8,11,18-19H,9-10,12-17H2,1-2H3,(H,29,33);1H,(H,2,3) |
| InChIKey | IXXWIHZIJCXUTG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 164.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|