C25H26N6O3 — CID 172760657
5-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-6-(5-methyl-3-pyridinyl)pyridine-2-carboxamide (PubChem CID 172760657) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 5-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-6-(5-methyl-3-pyridinyl)pyridine-2-carboxamide.
| Compound Name | 5-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-6-(5-methyl-3-pyridinyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 172760657 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 5-[1-[2-(2-methoxyethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-6-(5-methyl-3-pyridinyl)pyridine-2-carboxamide |
| SMILES | COCCOCCn1cc(-c2ccc(C(N)=O)nc2-c2cncc(C)c2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C25H26N6O3/c1-17-13-18(15-27-14-17)23-19(6-7-22(29-23)25(26)32)20-16-31(9-10-34-12-11-33-2)30-24(20)21-5-3-4-8-28-21/h3-8,13-16H,9-12H2,1-2H3,(H2,26,32) |
| InChIKey | LQGUGVUGAHHHCL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|