C12H29IN5- — CID 163824055
N-methyl-N'-[[4-[3-(methylamino)propyl]piperazin-1-yl]iodanuidylmethyl]ethane-1,2-diamine (PubChem CID 163824055) has the molecular formula C12H29IN5- and a molecular weight of 370.30 g/mol. Its IUPAC name is N-methyl-N'-[[4-[3-(methylamino)propyl]piperazin-1-yl]iodanuidylmethyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[[4-[3-(methylamino)propyl]piperazin-1-yl]iodanuidylmethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 163824055 |
| Molecular Formula | C12H29IN5- |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-methyl-N'-[[4-[3-(methylamino)propyl]piperazin-1-yl]iodanuidylmethyl]ethane-1,2-diamine |
| SMILES | CNCCCN1CCN([I-]CNCCNC)CC1 |
| InChI | InChI=1S/C12H29IN5/c1-14-4-3-7-17-8-10-18(11-9-17)13-12-16-6-5-15-2/h14-16H,3-12H2,1-2H3/q-1 |
| InChIKey | URQJHMGAYBESDD-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|