C44H33F3N2O10S — CID 163825197
3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-benzofuran-1,3-dione;methane (PubChem CID 163825197) has the molecular formula C44H33F3N2O10S and a molecular weight of 838.81 g/mol. Its IUPAC name is 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-benzofuran-1,3-dione;methane.
| Compound Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-benzofuran-1,3-dione;methane |
|---|---|
| PubChem CID | 163825197 |
| Molecular Formula | C44H33F3N2O10S |
| Molecular Weight | 838.81 g/mol |
| Exact Mass | 838.18 |
| IUPAC Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-benzofuran-1,3-dione;methane |
| SMILES | C.CC(c1ccc2c(c1)C(=O)OC2=O)(c1ccc2c(c1)C(=O)OC2=O)C(F)(F)F.Nc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C24H20N2O4S.C19H9F3O6.CH4/c25-17-3-1-5-21(15-17)29-19-7-11-23(12-8-19)31(27,28)24-13-9-20(10-14-24)30-22-6-2-4-18(26)16-22;1-18(19(20,21)22,8-2-4-10-12(6-8)16(25)27-14(10)23)9-3-5-11-13(7-9)17(26)28-15(11)24;/h1-16H,25-26H2;2-7H,1H3;1H4 |
| InChIKey | NYWHYTOYJUHNBQ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 191.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.81 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|