C40H26N2O10S — CID 170852032
3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (PubChem CID 170852032) has the molecular formula C40H26N2O10S and a molecular weight of 726.72 g/mol. Its IUPAC name is 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione.
| Compound Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 170852032 |
| Molecular Formula | C40H26N2O10S |
| Molecular Weight | 726.72 g/mol |
| Exact Mass | 726.13 |
| IUPAC Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| SMILES | Nc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N)c4)cc3)cc2)c1.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C24H20N2O4S.C16H6O6/c25-17-3-1-5-21(15-17)29-19-7-11-23(12-8-19)31(27,28)24-13-9-20(10-14-24)30-22-6-2-4-18(26)16-22;17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18/h1-16H,25-26H2;1-6H |
| InChIKey | FIRLZOVAGRSTLV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 191.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|