C43H24F6N2O8S — CID 102375277
5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[4-(4-phenoxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione (PubChem CID 102375277) has the molecular formula C43H24F6N2O8S and a molecular weight of 842.73 g/mol. Its IUPAC name is 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[4-(4-phenoxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[4-(4-phenoxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102375277 |
| Molecular Formula | C43H24F6N2O8S |
| Molecular Weight | 842.73 g/mol |
| Exact Mass | 842.12 |
| IUPAC Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[4-(4-phenoxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C(c3ccc4c(c3)C(=O)N(c3cccc(Oc5ccc(S(=O)(=O)c6ccc(Oc7ccccc7)cc6)cc5)c3)C4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C43H24F6N2O8S/c44-42(45,46)41(43(47,48)49,24-9-19-33-35(21-24)38(53)50-37(33)52)25-10-20-34-36(22-25)40(55)51(39(34)54)26-5-4-8-30(23-26)59-29-13-17-32(18-14-29)60(56,57)31-15-11-28(12-16-31)58-27-6-2-1-3-7-27/h1-23H,(H,50,52,53) |
| InChIKey | OLGOEKULUKBLMY-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.73 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|