C10H17NO5 — CID 163826614
(1S,2R,3S,8R)-1,2,8-trihydroxy-3-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 163826614) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (1S,2R,3S,8R)-1,2,8-trihydroxy-3-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R,3S,8R)-1,2,8-trihydroxy-3-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 163826614 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (1S,2R,3S,8R)-1,2,8-trihydroxy-3-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | O=C1CC[C@@H](O)C2[C@H](O)[C@H](O)[C@H](CCO)N12 |
| InChI | InChI=1S/C10H17NO5/c12-4-3-5-9(15)10(16)8-6(13)1-2-7(14)11(5)8/h5-6,8-10,12-13,15-16H,1-4H2/t5-,6+,8?,9+,10-/m0/s1 |
| InChIKey | OAAKGUNRXRGYBW-UQYSORRISA-N |
| XLogP | -2.18 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |