C21H25N3O2 — CID 163829900
N-hydroxy-4-[[3-(methylaminomethyl)-2-propylindol-1-yl]methyl]benzamide (PubChem CID 163829900) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-hydroxy-4-[[3-(methylaminomethyl)-2-propylindol-1-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[3-(methylaminomethyl)-2-propylindol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 163829900 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-hydroxy-4-[[3-(methylaminomethyl)-2-propylindol-1-yl]methyl]benzamide |
| SMILES | CCCc1c(CNC)c2ccccc2n1Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-6-19-18(13-22-2)17-7-4-5-8-20(17)24(19)14-15-9-11-16(12-10-15)21(25)23-26/h4-5,7-12,22,26H,3,6,13-14H2,1-2H3,(H,23,25) |
| InChIKey | OCUAJMLEGMXPLJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|