C24H22BrClF3N4O5+ — CID 163831057
1-[2-(2-bromoethoxy)ethyl]-7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7H-purin-7-ium-2,6-dione (PubChem CID 163831057) has the molecular formula C24H22BrClF3N4O5+ and a molecular weight of 618.81 g/mol. Its IUPAC name is 1-[2-(2-bromoethoxy)ethyl]-7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7H-purin-7-ium-2,6-dione.
| Compound Name | 1-[2-(2-bromoethoxy)ethyl]-7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 163831057 |
| Molecular Formula | C24H22BrClF3N4O5+ |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | 1-[2-(2-bromoethoxy)ethyl]-7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7H-purin-7-ium-2,6-dione |
| SMILES | Cn1c2c(c(=O)n(CCOCCBr)c1=O)[NH+](Cc1ccc(Cl)cc1)C(Oc1cccc(OC(F)(F)F)c1)=N2 |
| InChI | InChI=1S/C24H21BrClF3N4O5/c1-31-20-19(21(34)32(23(31)35)10-12-36-11-9-25)33(14-15-5-7-16(26)8-6-15)22(30-20)37-17-3-2-4-18(13-17)38-24(27,28)29/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | ODRCMFNTDIQZQI-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|