C30H25FN4O7S — CID 163831119
2-[[2-(2,1,3-benzothiadiazol-5-ylmethoxy)-4-[(2-fluoro-3-phenylphenyl)methoxy]-5-nitrophenyl]methylamino]-3-hydroxypropanoic acid (PubChem CID 163831119) has the molecular formula C30H25FN4O7S and a molecular weight of 604.62 g/mol. Its IUPAC name is 2-[[2-(2,1,3-benzothiadiazol-5-ylmethoxy)-4-[(2-fluoro-3-phenylphenyl)methoxy]-5-nitrophenyl]methylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-(2,1,3-benzothiadiazol-5-ylmethoxy)-4-[(2-fluoro-3-phenylphenyl)methoxy]-5-nitrophenyl]methylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 163831119 |
| Molecular Formula | C30H25FN4O7S |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | 2-[[2-(2,1,3-benzothiadiazol-5-ylmethoxy)-4-[(2-fluoro-3-phenylphenyl)methoxy]-5-nitrophenyl]methylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(CO)NCc1cc([N+](=O)[O-])c(OCc2cccc(-c3ccccc3)c2F)cc1OCc1ccc2nsnc2c1 |
| InChI | InChI=1S/C30H25FN4O7S/c31-29-20(7-4-8-22(29)19-5-2-1-3-6-19)17-42-28-13-27(41-16-18-9-10-23-24(11-18)34-43-33-23)21(12-26(28)35(39)40)14-32-25(15-36)30(37)38/h1-13,25,32,36H,14-17H2,(H,37,38) |
| InChIKey | ODSPBFNWRCKCJG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|