C8H17N — CID 163832178
cis-(2R,3S)-2-ethyl-3-methylcyclopentan-1-amine (PubChem CID 163832178) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is cis-(2R,3S)-2-ethyl-3-methylcyclopentan-1-amine.
| Compound Name | cis-(2R,3S)-2-ethyl-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 163832178 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | cis-(2R,3S)-2-ethyl-3-methylcyclopentan-1-amine |
| SMILES | CC[C@H]1C(N)CC[C@@H]1C |
| InChI | InChI=1S/C8H17N/c1-3-7-6(2)4-5-8(7)9/h6-8H,3-5,9H2,1-2H3/t6-,7+,8?/m0/s1 |
| InChIKey | OEOHFBZDHOCKQS-KJFJCRTCSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |