C12H23NO4 — CID 163836334
N-(1-cyclobutyl-4-ethoxy-3,4-dihydroxybutan-2-yl)acetamide (PubChem CID 163836334) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(1-cyclobutyl-4-ethoxy-3,4-dihydroxybutan-2-yl)acetamide.
| Compound Name | N-(1-cyclobutyl-4-ethoxy-3,4-dihydroxybutan-2-yl)acetamide |
|---|---|
| PubChem CID | 163836334 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-(1-cyclobutyl-4-ethoxy-3,4-dihydroxybutan-2-yl)acetamide |
| SMILES | CCOC(O)C(O)C(CC1CCC1)NC(C)=O |
| InChI | InChI=1S/C12H23NO4/c1-3-17-12(16)11(15)10(13-8(2)14)7-9-5-4-6-9/h9-12,15-16H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | OIAXYUJTDMHJIV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|