C15H11ClO6S — CID 163841907
4-[(2-carboxyphenyl)methyl]-3-chlorosulfonylbenzoic acid (PubChem CID 163841907) has the molecular formula C15H11ClO6S and a molecular weight of 354.77 g/mol. Its IUPAC name is 4-[(2-carboxyphenyl)methyl]-3-chlorosulfonylbenzoic acid.
| Compound Name | 4-[(2-carboxyphenyl)methyl]-3-chlorosulfonylbenzoic acid |
|---|---|
| PubChem CID | 163841907 |
| Molecular Formula | C15H11ClO6S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4-[(2-carboxyphenyl)methyl]-3-chlorosulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccccc2C(=O)O)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C15H11ClO6S/c16-23(21,22)13-8-11(14(17)18)6-5-10(13)7-9-3-1-2-4-12(9)15(19)20/h1-6,8H,7H2,(H,17,18)(H,19,20) |
| InChIKey | OMSTXMZWAAOSBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |