C30H42N6O8 — CID 163845812
N'-[4-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]butyl]-2-ethylpentanediamide (PubChem CID 163845812) has the molecular formula C30H42N6O8 and a molecular weight of 614.70 g/mol. Its IUPAC name is N'-[4-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]butyl]-2-ethylpentanediamide.
| Compound Name | N'-[4-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]butyl]-2-ethylpentanediamide |
|---|---|
| PubChem CID | 163845812 |
| Molecular Formula | C30H42N6O8 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | N'-[4-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]butyl]-2-ethylpentanediamide |
| SMILES | CCC(CCC(=O)NCCCCNC(=O)C(Cc1ccccc1)NC(=O)C(CO)NC(=O)CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C30H42N6O8/c1-2-21(28(31)42)10-11-24(38)32-15-6-7-16-33-29(43)22(18-20-8-4-3-5-9-20)35-30(44)23(19-37)34-25(39)14-17-36-26(40)12-13-27(36)41/h3-5,8-9,12-13,21-23,37H,2,6-7,10-11,14-19H2,1H3,(H2,31,42)(H,32,38)(H,33,43)(H,34,39)(H,35,44) |
| InChIKey | RKNWLVGNXRWFOR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|