C16H23NO5S — CID 163846032
2-[(4R)-4-(hydroxymethyl)-5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 163846032) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[(4R)-4-(hydroxymethyl)-5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(4R)-4-(hydroxymethyl)-5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 163846032 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[(4R)-4-(hydroxymethyl)-5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | CC(c1ccccc1)N1CC(CCOS(C)(=O)=O)[C@H](CO)C1=O |
| InChI | InChI=1S/C16H23NO5S/c1-12(13-6-4-3-5-7-13)17-10-14(15(11-18)16(17)19)8-9-22-23(2,20)21/h3-7,12,14-15,18H,8-11H2,1-2H3/t12?,14?,15-/m0/s1 |
| InChIKey | OQGAKRXOKRNXRX-ZALBZXLWSA-N |
| XLogP | 1.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|