C23H28N2O4S — CID 163846952
methyl 5-[2-(1-benzoyloxypiperidin-4-yl)pyrrolidin-1-yl]-4-methylthiophene-3-carboxylate (PubChem CID 163846952) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is methyl 5-[2-(1-benzoyloxypiperidin-4-yl)pyrrolidin-1-yl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-[2-(1-benzoyloxypiperidin-4-yl)pyrrolidin-1-yl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 163846952 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | methyl 5-[2-(1-benzoyloxypiperidin-4-yl)pyrrolidin-1-yl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(N2CCCC2C2CCN(OC(=O)c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C23H28N2O4S/c1-16-19(23(27)28-2)15-30-21(16)25-12-6-9-20(25)17-10-13-24(14-11-17)29-22(26)18-7-4-3-5-8-18/h3-5,7-8,15,17,20H,6,9-14H2,1-2H3 |
| InChIKey | ORACLZAEBCFPMX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |