C24H24N2O4S — CID 163453538
methyl 3-[(1-benzoyloxypiperidin-4-yl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 163453538) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is methyl 3-[(1-benzoyloxypiperidin-4-yl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-benzoyloxypiperidin-4-yl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 163453538 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 3-[(1-benzoyloxypiperidin-4-yl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC1CCN(OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H24N2O4S/c1-29-24(28)22-20(16-21(31-22)17-8-4-2-5-9-17)25-19-12-14-26(15-13-19)30-23(27)18-10-6-3-7-11-18/h2-11,16,19,25H,12-15H2,1H3 |
| InChIKey | BINHCXDKZSXJJT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |