C14H20O3 — CID 163847185
4-[(4aR)-1-oxo-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-2-yl]butanoic acid (PubChem CID 163847185) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-[(4aR)-1-oxo-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-2-yl]butanoic acid.
| Compound Name | 4-[(4aR)-1-oxo-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 163847185 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-[(4aR)-1-oxo-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-2-yl]butanoic acid |
| SMILES | O=C(O)CCCC1CC[C@@H]2C=CCCC2C1=O |
| InChI | InChI=1S/C14H20O3/c15-13(16)7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)17/h1,4,10-12H,2-3,5-9H2,(H,15,16)/t10-,11?,12?/m0/s1 |
| InChIKey | ORFICKQDLLEJOG-UNXYVOJBSA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|