C13H18O6S — CID 130198008
4-[3-(3-carboxypropylsulfanyl)-2,5-dioxocyclopentyl]butanoic acid (PubChem CID 130198008) has the molecular formula C13H18O6S and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[3-(3-carboxypropylsulfanyl)-2,5-dioxocyclopentyl]butanoic acid.
| Compound Name | 4-[3-(3-carboxypropylsulfanyl)-2,5-dioxocyclopentyl]butanoic acid |
|---|---|
| PubChem CID | 130198008 |
| Molecular Formula | C13H18O6S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-[3-(3-carboxypropylsulfanyl)-2,5-dioxocyclopentyl]butanoic acid |
| SMILES | O=C(O)CCCSC1CC(=O)C(CCCC(=O)O)C1=O |
| InChI | InChI=1S/C13H18O6S/c14-9-7-10(20-6-2-5-12(17)18)13(19)8(9)3-1-4-11(15)16/h8,10H,1-7H2,(H,15,16)(H,17,18) |
| InChIKey | UKNHOWVCULCSKI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|