C18H32O3S2 — CID 150923477
6-[(1S,2S)-2-heptylsulfanyl-5-oxocyclopentyl]sulfanylhexanoic acid (PubChem CID 150923477) has the molecular formula C18H32O3S2 and a molecular weight of 360.59 g/mol. Its IUPAC name is 6-[(1S,2S)-2-heptylsulfanyl-5-oxocyclopentyl]sulfanylhexanoic acid.
| Compound Name | 6-[(1S,2S)-2-heptylsulfanyl-5-oxocyclopentyl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 150923477 |
| Molecular Formula | C18H32O3S2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[(1S,2S)-2-heptylsulfanyl-5-oxocyclopentyl]sulfanylhexanoic acid |
| SMILES | CCCCCCCS[C@H]1CCC(=O)[C@@H]1SCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3S2/c1-2-3-4-5-8-13-22-16-12-11-15(19)18(16)23-14-9-6-7-10-17(20)21/h16,18H,2-14H2,1H3,(H,20,21)/t16-,18-/m0/s1 |
| InChIKey | LENIYNNYZCHEOJ-WMZOPIPTSA-N |
| XLogP | 5.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|