C12H24N3+ — CID 163847346
amino-(3-amino-5-methylhepta-1,3,5-trien-4-yl)-butan-2-ylazanium (PubChem CID 163847346) has the molecular formula C12H24N3+ and a molecular weight of 210.34 g/mol. Its IUPAC name is amino-(3-amino-5-methylhepta-1,3,5-trien-4-yl)-butan-2-ylazanium.
| Compound Name | amino-(3-amino-5-methylhepta-1,3,5-trien-4-yl)-butan-2-ylazanium |
|---|---|
| PubChem CID | 163847346 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | amino-(3-amino-5-methylhepta-1,3,5-trien-4-yl)-butan-2-ylazanium |
| SMILES | C=CC(N)=C(C(C)=CC)[NH+](N)C(C)CC |
| InChI | InChI=1S/C12H23N3/c1-6-9(4)12(11(13)8-3)15(14)10(5)7-2/h6,8,10H,3,7,13-14H2,1-2,4-5H3/p+1 |
| InChIKey | ORHZUPBSHUBFPX-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 56.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|