C22H20F2N6O3S — CID 163847905
N-[4-[[1-[[diazenyl(methyl)amino]methyl]indol-2-yl]oxymethyl]-1,3-thiazol-2-yl]-2,2-difluoro-2-phenoxyacetamide (PubChem CID 163847905) has the molecular formula C22H20F2N6O3S and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[4-[[1-[[diazenyl(methyl)amino]methyl]indol-2-yl]oxymethyl]-1,3-thiazol-2-yl]-2,2-difluoro-2-phenoxyacetamide.
| Compound Name | N-[4-[[1-[[diazenyl(methyl)amino]methyl]indol-2-yl]oxymethyl]-1,3-thiazol-2-yl]-2,2-difluoro-2-phenoxyacetamide |
|---|---|
| PubChem CID | 163847905 |
| Molecular Formula | C22H20F2N6O3S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[4-[[1-[[diazenyl(methyl)amino]methyl]indol-2-yl]oxymethyl]-1,3-thiazol-2-yl]-2,2-difluoro-2-phenoxyacetamide |
| SMILES | [H]/N=N/N(C)Cn1c(OCc2csc(NC(=O)C(F)(F)Oc3ccccc3)n2)cc2ccccc21 |
| InChI | InChI=1S/C22H20F2N6O3S/c1-29(28-25)14-30-18-10-6-5-7-15(18)11-19(30)32-12-16-13-34-21(26-16)27-20(31)22(23,24)33-17-8-3-2-4-9-17/h2-11,13,25H,12,14H2,1H3,(H,26,27,31)/b28-25+ |
| InChIKey | ORTSRSSHIXTQDF-AZPGRJICSA-N |
| XLogP | 5.12 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|