C20H22O2 — CID 163848347
6-(4-propan-2-ylidenecyclohexyl)oxynaphthalene-2-carbaldehyde (PubChem CID 163848347) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 6-(4-propan-2-ylidenecyclohexyl)oxynaphthalene-2-carbaldehyde.
| Compound Name | 6-(4-propan-2-ylidenecyclohexyl)oxynaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 163848347 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 6-(4-propan-2-ylidenecyclohexyl)oxynaphthalene-2-carbaldehyde |
| SMILES | CC(C)=C1CCC(Oc2ccc3cc(C=O)ccc3c2)CC1 |
| InChI | InChI=1S/C20H22O2/c1-14(2)16-5-8-19(9-6-16)22-20-10-7-17-11-15(13-21)3-4-18(17)12-20/h3-4,7,10-13,19H,5-6,8-9H2,1-2H3 |
| InChIKey | OSDXBAUZGSWJBD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|