C19H22O3 — CID 91664543
6-[4-(methoxymethyl)cyclohexyl]oxynaphthalene-2-carbaldehyde (PubChem CID 91664543) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-[4-(methoxymethyl)cyclohexyl]oxynaphthalene-2-carbaldehyde.
| Compound Name | 6-[4-(methoxymethyl)cyclohexyl]oxynaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 91664543 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 6-[4-(methoxymethyl)cyclohexyl]oxynaphthalene-2-carbaldehyde |
| SMILES | COCC1CCC(Oc2ccc3cc(C=O)ccc3c2)CC1 |
| InChI | InChI=1S/C19H22O3/c1-21-13-14-3-7-18(8-4-14)22-19-9-6-16-10-15(12-20)2-5-17(16)11-19/h2,5-6,9-12,14,18H,3-4,7-8,13H2,1H3 |
| InChIKey | ZRMQUKRPPJGDCD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|