C42H29NO2S2 — CID 163848503
10-phenyl-8-(4-triphenylen-2-ylsulfonylphenyl)-4a,10a-dihydrophenothiazine (PubChem CID 163848503) has the molecular formula C42H29NO2S2 and a molecular weight of 643.83 g/mol. Its IUPAC name is 10-phenyl-8-(4-triphenylen-2-ylsulfonylphenyl)-4a,10a-dihydrophenothiazine.
| Compound Name | 10-phenyl-8-(4-triphenylen-2-ylsulfonylphenyl)-4a,10a-dihydrophenothiazine |
|---|---|
| PubChem CID | 163848503 |
| Molecular Formula | C42H29NO2S2 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | 10-phenyl-8-(4-triphenylen-2-ylsulfonylphenyl)-4a,10a-dihydrophenothiazine |
| SMILES | O=S(=O)(c1ccc(-c2ccc3c(c2)N(c2ccccc2)C2C=CC=CC2S3)cc1)c1ccc2c3ccccc3c3ccccc3c2c1 |
| InChI | InChI=1S/C42H29NO2S2/c44-47(45,32-23-24-37-35-14-5-4-12-33(35)34-13-6-7-15-36(34)38(37)27-32)31-21-18-28(19-22-31)29-20-25-42-40(26-29)43(30-10-2-1-3-11-30)39-16-8-9-17-41(39)46-42/h1-27,39,41H |
| InChIKey | OSGTYVLLTLQZNV-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|