C6H11NO2 — CID 163851221
(3E,5Z)-6-aminohexa-3,5-diene-2,3-diol (PubChem CID 163851221) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (3E,5Z)-6-aminohexa-3,5-diene-2,3-diol.
| Compound Name | (3E,5Z)-6-aminohexa-3,5-diene-2,3-diol |
|---|---|
| PubChem CID | 163851221 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (3E,5Z)-6-aminohexa-3,5-diene-2,3-diol |
| SMILES | CC(O)/C(O)=C\C=C/N |
| InChI | InChI=1S/C6H11NO2/c1-5(8)6(9)3-2-4-7/h2-5,8-9H,7H2,1H3/b4-2-,6-3+ |
| InChIKey | OUNLZWJXQZLLAW-MDNDHVJUSA-N |
| XLogP | 0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|