C7H11NO2 — CID 143661098
(1E,3E,5E)-6-amino-5-methylhexa-1,3,5-triene-1,4-diol (PubChem CID 143661098) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (1E,3E,5E)-6-amino-5-methylhexa-1,3,5-triene-1,4-diol.
| Compound Name | (1E,3E,5E)-6-amino-5-methylhexa-1,3,5-triene-1,4-diol |
|---|---|
| PubChem CID | 143661098 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (1E,3E,5E)-6-amino-5-methylhexa-1,3,5-triene-1,4-diol |
| SMILES | CC(=C\N)/C(O)=C\C=C\O |
| InChI | InChI=1S/C7H11NO2/c1-6(5-8)7(10)3-2-4-9/h2-5,9-10H,8H2,1H3/b4-2+,6-5+,7-3+ |
| InChIKey | SSGDRIQVCIQAJI-YZUJEAJNSA-N |
| XLogP | 1.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|