C19H24N2O4S2 — CID 163851368
2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]propanoylamino]pentanoic acid (PubChem CID 163851368) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]propanoylamino]pentanoic acid.
| Compound Name | 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 163851368 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]propanoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)CCN1C(=O)/C(=C\c2ccc(C)cc2)SC1S)C(=O)O |
| InChI | InChI=1S/C19H24N2O4S2/c1-3-4-14(18(24)25)20-16(22)9-10-21-17(23)15(27-19(21)26)11-13-7-5-12(2)6-8-13/h5-8,11,14,19,26H,3-4,9-10H2,1-2H3,(H,20,22)(H,24,25)/b15-11+ |
| InChIKey | OUPVSGNFWCJNQB-RVDMUPIBSA-N |
| XLogP | 2.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|